C10H11N5OS — CID 61397241
2-(2-azidoethylsulfanyl)-6-methoxy-1H-benzimidazole (PubChem CID 61397241) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-(2-azidoethylsulfanyl)-6-methoxy-1H-benzimidazole.
| Compound Name | 2-(2-azidoethylsulfanyl)-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 61397241 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(2-azidoethylsulfanyl)-6-methoxy-1H-benzimidazole |
| SMILES | COc1ccc2nc(SCCN=[N+]=[N-])[nH]c2c1 |
| InChI | InChI=1S/C10H11N5OS/c1-16-7-2-3-8-9(6-7)14-10(13-8)17-5-4-12-15-11/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | JBGAXPWWQWXFTR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|