C12H10ClN5OS — CID 80735327
4-chloro-6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-2-amine (PubChem CID 80735327) has the molecular formula C12H10ClN5OS and a molecular weight of 307.77 g/mol. Its IUPAC name is 4-chloro-6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 80735327 |
| Molecular Formula | C12H10ClN5OS |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 4-chloro-6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-2-amine |
| SMILES | COc1ccc2nc(Sc3cc(Cl)nc(N)n3)[nH]c2c1 |
| InChI | InChI=1S/C12H10ClN5OS/c1-19-6-2-3-7-8(4-6)16-12(15-7)20-10-5-9(13)17-11(14)18-10/h2-5H,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | WAZHDYFPPDZHLU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |