C15H12ClFN2OS — CID 134065477
2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-6-methoxy-1H-benzimidazole (PubChem CID 134065477) has the molecular formula C15H12ClFN2OS and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-6-methoxy-1H-benzimidazole.
| Compound Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-6-methoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 134065477 |
| Molecular Formula | C15H12ClFN2OS |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-6-methoxy-1H-benzimidazole |
| SMILES | COc1ccc2nc(SCc3ccc(Cl)cc3F)[nH]c2c1 |
| InChI | InChI=1S/C15H12ClFN2OS/c1-20-11-4-5-13-14(7-11)19-15(18-13)21-8-9-2-3-10(16)6-12(9)17/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | XHYLIDIWDLKQCD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |