C14H12N2O3S2 — CID 63639169
3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]thiophene-2-carboxylic acid (PubChem CID 63639169) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63639169 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]thiophene-2-carboxylic acid |
| SMILES | COc1ccc2nc(SCc3ccsc3C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C14H12N2O3S2/c1-19-9-2-3-10-11(6-9)16-14(15-10)21-7-8-4-5-20-12(8)13(17)18/h2-6H,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | PCHMXLALXFFAAX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |