C18H14N2O4S — CID 7152429
7-hydroxy-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]chromen-2-one (PubChem CID 7152429) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is 7-hydroxy-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]chromen-2-one.
| Compound Name | 7-hydroxy-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 7152429 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 7-hydroxy-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]chromen-2-one |
| SMILES | COc1ccc2nc(SCc3cc(=O)oc4cc(O)ccc34)[nH]c2c1 |
| InChI | InChI=1S/C18H14N2O4S/c1-23-12-3-5-14-15(8-12)20-18(19-14)25-9-10-6-17(22)24-16-7-11(21)2-4-13(10)16/h2-8,21H,9H2,1H3,(H,19,20) |
| InChIKey | IIYINTLCJDMBNQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|