C19H15ClN2O2S — CID 4574638
4-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 4574638) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 4-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 4574638 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3nc4ccc(Cl)cc4[nH]3)cc(=O)oc2c1C |
| InChI | InChI=1S/C19H15ClN2O2S/c1-10-3-5-14-12(7-17(23)24-18(14)11(10)2)9-25-19-21-15-6-4-13(20)8-16(15)22-19/h3-8H,9H2,1-2H3,(H,21,22) |
| InChIKey | SYFDBXQSRLZOOZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|