C16H15N3O3S — CID 135445843
4-amino-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135445843) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-amino-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135445843 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 4-amino-2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc2c(CSc3nc(N)cc(=O)[nH]3)cc(=O)oc2c1C |
| InChI | InChI=1S/C16H15N3O3S/c1-8-3-4-11-10(5-14(21)22-15(11)9(8)2)7-23-16-18-12(17)6-13(20)19-16/h3-6H,7H2,1-2H3,(H3,17,18,19,20) |
| InChIKey | QLCPMTLCEKDKJZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|