C17H14ClNO2S — CID 112815626
4-[(5-chloro-2-pyridinyl)sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 112815626) has the molecular formula C17H14ClNO2S and a molecular weight of 331.82 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[(5-chloro-2-pyridinyl)sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 112815626 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3ccc(Cl)cn3)cc(=O)oc2c1C |
| InChI | InChI=1S/C17H14ClNO2S/c1-10-3-5-14-12(7-16(20)21-17(14)11(10)2)9-22-15-6-4-13(18)8-19-15/h3-8H,9H2,1-2H3 |
| InChIKey | IVNPNIDLTOZDSB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|