C17H13ClN4OS — CID 34173298
2-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-3-methylquinazolin-4-one (PubChem CID 34173298) has the molecular formula C17H13ClN4OS and a molecular weight of 356.84 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-3-methylquinazolin-4-one.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 34173298 |
| Molecular Formula | C17H13ClN4OS |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanylmethyl]-3-methylquinazolin-4-one |
| SMILES | Cn1c(CSc2nc3ccc(Cl)cc3[nH]2)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H13ClN4OS/c1-22-15(19-12-5-3-2-4-11(12)16(22)23)9-24-17-20-13-7-6-10(18)8-14(13)21-17/h2-8H,9H2,1H3,(H,20,21) |
| InChIKey | PNPKWUVHGRTQGD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |