C18H17ClN4OS — CID 4883267
2-[6-chloro-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol (PubChem CID 4883267) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is 2-[6-chloro-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol.
| Compound Name | 2-[6-chloro-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 4883267 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-[6-chloro-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]benzimidazol-1-yl]ethanol |
| SMILES | Cc1ccc2nc(SCc3nc4ccc(Cl)cc4n3CCO)[nH]c2c1 |
| InChI | InChI=1S/C18H17ClN4OS/c1-11-2-4-13-15(8-11)22-18(21-13)25-10-17-20-14-5-3-12(19)9-16(14)23(17)6-7-24/h2-5,8-9,24H,6-7,10H2,1H3,(H,21,22) |
| InChIKey | KLFRTCIFVPQIDE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |