C16H14N2OS2 — CID 62874931
3-[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 62874931) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 3-[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 62874931 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-[2-[(6-methyl-1H-benzimidazol-2-yl)sulfanylmethyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | Cc1ccc2nc(SCc3sccc3C#CCO)[nH]c2c1 |
| InChI | InChI=1S/C16H14N2OS2/c1-11-4-5-13-14(9-11)18-16(17-13)21-10-15-12(3-2-7-19)6-8-20-15/h4-6,8-9,19H,7,10H2,1H3,(H,17,18) |
| InChIKey | MOTYMVVSUHZNFK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|