C10H12N2S — CID 923755
2-ethylsulfanyl-6-methyl-1H-benzimidazole (PubChem CID 923755) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-methyl-1H-benzimidazole.
| Compound Name | 2-ethylsulfanyl-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 923755 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-ethylsulfanyl-6-methyl-1H-benzimidazole |
| SMILES | CCSc1nc2ccc(C)cc2[nH]1 |
| InChI | InChI=1S/C10H12N2S/c1-3-13-10-11-8-5-4-7(2)6-9(8)12-10/h4-6H,3H2,1-2H3,(H,11,12) |
| InChIKey | DFRHBUFOZJREHX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |