C11H15ClN2OS — CID 5344707
6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hydrochloride (PubChem CID 5344707) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hydrochloride.
| Compound Name | 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hydrochloride |
|---|---|
| PubChem CID | 5344707 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hydrochloride |
| SMILES | CCOc1ccc2nc(SCC)[nH]c2c1.Cl |
| InChI | InChI=1S/C11H14N2OS.ClH/c1-3-14-8-5-6-9-10(7-8)13-11(12-9)15-4-2;/h5-7H,3-4H2,1-2H3,(H,12,13);1H |
| InChIKey | CDKXGFXNRMGHNY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |