C19H22N2O3S — CID 5169709
6-ethoxy-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1H-benzimidazole (PubChem CID 5169709) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 6-ethoxy-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1H-benzimidazole.
| Compound Name | 6-ethoxy-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 5169709 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 6-ethoxy-2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-1H-benzimidazole |
| SMILES | CCOc1ccc(OCCSc2nc3ccc(OCC)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-3-22-14-5-7-15(8-6-14)24-11-12-25-19-20-17-10-9-16(23-4-2)13-18(17)21-19/h5-10,13H,3-4,11-12H2,1-2H3,(H,20,21) |
| InChIKey | YLMBFYIXPXDLHZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|