6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid

C11H15ClN2O2S — CID 159344555

IUPAC6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid
SMILESCCOc1ccc2nc(SCC)[nH]c2c1.OCl
InChIInChI=1S/C11H14N2OS.ClHO/c1-3-14-8-5-6-9-10(7-8)13-11(12-9)15-4-2;1-2/h5-7H,3-4H2,1-2H3,(H,12,13);2H
InChIKeyLGOBMYGBXINGFV-UHFFFAOYSA-N
MW274.77 g/mol
LogP3.21
Rot. Bonds4

About 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid

6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid (PubChem CID 159344555) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid.

Molecular Properties

Compound Name6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid
PubChem CID159344555
Molecular FormulaC11H15ClN2O2S
Molecular Weight274.77 g/mol
Exact Mass274.05
IUPAC Name6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid
SMILESCCOc1ccc2nc(SCC)[nH]c2c1.OCl
InChIInChI=1S/C11H14N2OS.ClHO/c1-3-14-8-5-6-9-10(7-8)13-11(12-9)15-4-2;1-2/h5-7H,3-4H2,1-2H3,(H,12,13);2H
InChIKeyLGOBMYGBXINGFV-UHFFFAOYSA-N
XLogP3.21
TPSA58.14 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.77
LogP ≤ 53.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid?
The IUPAC name of 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid (CID 159344555) is 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid.
What is the SMILES notation for 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid?
The canonical SMILES for 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid is CCOc1ccc2nc(SCC)[nH]c2c1.OCl.
What is the InChIKey of 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid?
The InChIKey is LGOBMYGBXINGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS.ClHO/c1-3-14-8-5-6-9-10(7-8)13-11(12-9)15-4-2;1-2/h5-7H,3-4H2,1-2H3,(H,12,13);2H.
What are the key properties of 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid?
6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid has a molecular weight of 274.77 g/mol, XLogP of 3.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2-ethylsulfanyl-1H-benzimidazole;hypochlorous acid is sourced from PubChem (CID 159344555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).