C16H14Cl2N2OS — CID 4666829
2-[(2,6-dichlorophenyl)methylsulfanyl]-6-ethoxy-1H-benzimidazole (PubChem CID 4666829) has the molecular formula C16H14Cl2N2OS and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylsulfanyl]-6-ethoxy-1H-benzimidazole.
| Compound Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-6-ethoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 4666829 |
| Molecular Formula | C16H14Cl2N2OS |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylsulfanyl]-6-ethoxy-1H-benzimidazole |
| SMILES | CCOc1ccc2nc(SCc3c(Cl)cccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C16H14Cl2N2OS/c1-2-21-10-6-7-14-15(8-10)20-16(19-14)22-9-11-12(17)4-3-5-13(11)18/h3-8H,2,9H2,1H3,(H,19,20) |
| InChIKey | HIPOHCNKHRHLSR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |