C14H19BrN2OS — CID 65000521
2-(3-bromo-2,2-dimethylpropyl)sulfanyl-6-ethoxy-1H-benzimidazole (PubChem CID 65000521) has the molecular formula C14H19BrN2OS and a molecular weight of 343.29 g/mol. Its IUPAC name is 2-(3-bromo-2,2-dimethylpropyl)sulfanyl-6-ethoxy-1H-benzimidazole.
| Compound Name | 2-(3-bromo-2,2-dimethylpropyl)sulfanyl-6-ethoxy-1H-benzimidazole |
|---|---|
| PubChem CID | 65000521 |
| Molecular Formula | C14H19BrN2OS |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-(3-bromo-2,2-dimethylpropyl)sulfanyl-6-ethoxy-1H-benzimidazole |
| SMILES | CCOc1ccc2nc(SCC(C)(C)CBr)[nH]c2c1 |
| InChI | InChI=1S/C14H19BrN2OS/c1-4-18-10-5-6-11-12(7-10)17-13(16-11)19-9-14(2,3)8-15/h5-7H,4,8-9H2,1-3H3,(H,16,17) |
| InChIKey | MYNFCQRSZKLSKX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|