C12H13BF3N2OS- — CID 106746902
3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide (PubChem CID 106746902) has the molecular formula C12H13BF3N2OS- and a molecular weight of 301.12 g/mol. Its IUPAC name is 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide.
| Compound Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide |
|---|---|
| PubChem CID | 106746902 |
| Molecular Formula | C12H13BF3N2OS- |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]prop-1-en-2-yl-trifluoroboranuide |
| SMILES | C=C(CSc1nc2ccc(OCC)cc2[nH]1)[B-](F)(F)F |
| InChI | InChI=1S/C12H13BF3N2OS/c1-3-19-9-4-5-10-11(6-9)18-12(17-10)20-7-8(2)13(14,15)16/h4-6H,2-3,7H2,1H3,(H,17,18)/q-1 |
| InChIKey | PKVJREXSNSAOAK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|