C15H21N3O2S — CID 4816437
2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N,N-diethylacetamide (PubChem CID 4816437) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N,N-diethylacetamide.
| Compound Name | 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 4816437 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-N,N-diethylacetamide |
| SMILES | CCOc1ccc2nc(SCC(=O)N(CC)CC)[nH]c2c1 |
| InChI | InChI=1S/C15H21N3O2S/c1-4-18(5-2)14(19)10-21-15-16-12-8-7-11(20-6-3)9-13(12)17-15/h7-9H,4-6,10H2,1-3H3,(H,16,17) |
| InChIKey | PCLLLOULPISBIN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |