C9H10N2O2S — CID 119085221
6-ethoxy-2-hydroxysulfanyl-1H-benzimidazole (PubChem CID 119085221) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 6-ethoxy-2-hydroxysulfanyl-1H-benzimidazole.
| Compound Name | 6-ethoxy-2-hydroxysulfanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 119085221 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 6-ethoxy-2-hydroxysulfanyl-1H-benzimidazole |
| SMILES | CCOc1ccc2nc(SO)[nH]c2c1 |
| InChI | InChI=1S/C9H10N2O2S/c1-2-13-6-3-4-7-8(5-6)11-9(10-7)14-12/h3-5,12H,2H2,1H3,(H,10,11) |
| InChIKey | GRSMTLQVGYKUCX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|