C13H16N2O2S — CID 43218622
3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]butan-2-one (PubChem CID 43218622) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]butan-2-one.
| Compound Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]butan-2-one |
|---|---|
| PubChem CID | 43218622 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]butan-2-one |
| SMILES | CCOc1ccc2nc(SC(C)C(C)=O)[nH]c2c1 |
| InChI | InChI=1S/C13H16N2O2S/c1-4-17-10-5-6-11-12(7-10)15-13(14-11)18-9(3)8(2)16/h5-7,9H,4H2,1-3H3,(H,14,15) |
| InChIKey | UHOXXKHLSMDFID-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |