C15H22N2O3S — CID 60670681
1-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol (PubChem CID 60670681) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 60670681 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-3-propan-2-yloxypropan-2-ol |
| SMILES | CCOc1ccc2nc(SCC(O)COC(C)C)[nH]c2c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-4-19-12-5-6-13-14(7-12)17-15(16-13)21-9-11(18)8-20-10(2)3/h5-7,10-11,18H,4,8-9H2,1-3H3,(H,16,17) |
| InChIKey | UWLKCZPEHUNZFO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |