C16H15IN2OS — CID 65491332
6-ethoxy-2-[(4-iodophenyl)methylsulfanyl]-1H-benzimidazole (PubChem CID 65491332) has the molecular formula C16H15IN2OS and a molecular weight of 410.28 g/mol. Its IUPAC name is 6-ethoxy-2-[(4-iodophenyl)methylsulfanyl]-1H-benzimidazole.
| Compound Name | 6-ethoxy-2-[(4-iodophenyl)methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 65491332 |
| Molecular Formula | C16H15IN2OS |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 6-ethoxy-2-[(4-iodophenyl)methylsulfanyl]-1H-benzimidazole |
| SMILES | CCOc1ccc2nc(SCc3ccc(I)cc3)[nH]c2c1 |
| InChI | InChI=1S/C16H15IN2OS/c1-2-20-13-7-8-14-15(9-13)19-16(18-14)21-10-11-3-5-12(17)6-4-11/h3-9H,2,10H2,1H3,(H,18,19) |
| InChIKey | LSAPUVRQNGOIID-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|