C16H18N4S2 — CID 144612475
6-methyl-2-[(6-methyl-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole;molecular hydrogen (PubChem CID 144612475) has the molecular formula C16H18N4S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 6-methyl-2-[(6-methyl-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole;molecular hydrogen.
| Compound Name | 6-methyl-2-[(6-methyl-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole;molecular hydrogen |
|---|---|
| PubChem CID | 144612475 |
| Molecular Formula | C16H18N4S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 6-methyl-2-[(6-methyl-1H-benzimidazol-2-yl)disulfanyl]-1H-benzimidazole;molecular hydrogen |
| SMILES | Cc1ccc2nc(SSc3nc4ccc(C)cc4[nH]3)[nH]c2c1.[H][H].[H][H] |
| InChI | InChI=1S/C16H14N4S2.2H2/c1-9-3-5-11-13(7-9)19-15(17-11)21-22-16-18-12-6-4-10(2)8-14(12)20-16;;/h3-8H,1-2H3,(H,17,19)(H,18,20);2*1H |
| InChIKey | BGXLXZVIPPEVCB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|