C13H13N5S — CID 80892676
2-methyl-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-4-amine (PubChem CID 80892676) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-methyl-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80892676 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-methyl-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]pyrimidin-4-amine |
| SMILES | Cc1ccc2nc(Sc3cc(N)nc(C)n3)[nH]c2c1 |
| InChI | InChI=1S/C13H13N5S/c1-7-3-4-9-10(5-7)18-13(17-9)19-12-6-11(14)15-8(2)16-12/h3-6H,1-2H3,(H,17,18)(H2,14,15,16) |
| InChIKey | ZZLKDRBHLVUVRT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |