C13H13N5S — CID 61372787
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3H-benzimidazol-5-amine (PubChem CID 61372787) has the molecular formula C13H13N5S and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3H-benzimidazol-5-amine.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 61372787 |
| Molecular Formula | C13H13N5S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3H-benzimidazol-5-amine |
| SMILES | Cc1cc(C)nc(Sc2nc3ccc(N)cc3[nH]2)n1 |
| InChI | InChI=1S/C13H13N5S/c1-7-5-8(2)16-12(15-7)19-13-17-10-4-3-9(14)6-11(10)18-13/h3-6H,14H2,1-2H3,(H,17,18) |
| InChIKey | LTEGOWGCGLHORQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|