C11H9N5OS — CID 114585580
4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-1H-pyrimidin-6-one (PubChem CID 114585580) has the molecular formula C11H9N5OS and a molecular weight of 259.29 g/mol. Its IUPAC name is 4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114585580 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 4-[(6-amino-1H-benzimidazol-2-yl)sulfanyl]-1H-pyrimidin-6-one |
| SMILES | Nc1ccc2nc(Sc3cc(=O)[nH]cn3)[nH]c2c1 |
| InChI | InChI=1S/C11H9N5OS/c12-6-1-2-7-8(3-6)16-11(15-7)18-10-4-9(17)13-5-14-10/h1-5H,12H2,(H,15,16)(H,13,14,17) |
| InChIKey | JKIWHLCUEJNXRN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|