C13H19N3S — CID 54958043
2-(3,3-dimethylbutylsulfanyl)-3H-benzimidazol-5-amine (PubChem CID 54958043) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylsulfanyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(3,3-dimethylbutylsulfanyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 54958043 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-(3,3-dimethylbutylsulfanyl)-3H-benzimidazol-5-amine |
| SMILES | CC(C)(C)CCSc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C13H19N3S/c1-13(2,3)6-7-17-12-15-10-5-4-9(14)8-11(10)16-12/h4-5,8H,6-7,14H2,1-3H3,(H,15,16) |
| InChIKey | DMHBNHUFZVOVRN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|