C16H18N4OS — CID 143294190
2-[2-(4-methoxy-3-methyl-2-pyridinyl)ethylsulfanyl]-3H-benzimidazol-5-amine (PubChem CID 143294190) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[2-(4-methoxy-3-methyl-2-pyridinyl)ethylsulfanyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[2-(4-methoxy-3-methyl-2-pyridinyl)ethylsulfanyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 143294190 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[2-(4-methoxy-3-methyl-2-pyridinyl)ethylsulfanyl]-3H-benzimidazol-5-amine |
| SMILES | COc1ccnc(CCSc2nc3ccc(N)cc3[nH]2)c1C |
| InChI | InChI=1S/C16H18N4OS/c1-10-12(18-7-5-15(10)21-2)6-8-22-16-19-13-4-3-11(17)9-14(13)20-16/h3-5,7,9H,6,8,17H2,1-2H3,(H,19,20) |
| InChIKey | CWFYWIAPCDOXNJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|