C10H11N3S — CID 84617420
2-prop-2-enylsulfanyl-3H-benzimidazol-5-amine (PubChem CID 84617420) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-3H-benzimidazol-5-amine.
| Compound Name | 2-prop-2-enylsulfanyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 84617420 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-prop-2-enylsulfanyl-3H-benzimidazol-5-amine |
| SMILES | C=CCSc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C10H11N3S/c1-2-5-14-10-12-8-4-3-7(11)6-9(8)13-10/h2-4,6H,1,5,11H2,(H,12,13) |
| InChIKey | AIQCRBVAOACBJQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|