C12H16N4S — CID 102820465
2-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]-3H-benzimidazol-5-amine (PubChem CID 102820465) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 102820465 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(SC[C@H]3CCCN3)[nH]c2c1 |
| InChI | InChI=1S/C12H16N4S/c13-8-3-4-10-11(6-8)16-12(15-10)17-7-9-2-1-5-14-9/h3-4,6,9,14H,1-2,5,7,13H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | BZVGNCGRLQJQDT-SECBINFHSA-N |
| XLogP | 1.99 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|