C11H15BrN2S — CID 82840688
3-bromo-4-(pyrrolidin-2-ylmethylsulfanyl)aniline (PubChem CID 82840688) has the molecular formula C11H15BrN2S and a molecular weight of 287.23 g/mol. Its IUPAC name is 3-bromo-4-(pyrrolidin-2-ylmethylsulfanyl)aniline.
| Compound Name | 3-bromo-4-(pyrrolidin-2-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 82840688 |
| Molecular Formula | C11H15BrN2S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 3-bromo-4-(pyrrolidin-2-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(SCC2CCCN2)c(Br)c1 |
| InChI | InChI=1S/C11H15BrN2S/c12-10-6-8(13)3-4-11(10)15-7-9-2-1-5-14-9/h3-4,6,9,14H,1-2,5,7,13H2 |
| InChIKey | WXQFDVDACHQDRV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|