C13H19NS — CID 102820293
(2R)-2-[(2,4-dimethylphenyl)sulfanylmethyl]pyrrolidine (PubChem CID 102820293) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is (2R)-2-[(2,4-dimethylphenyl)sulfanylmethyl]pyrrolidine.
| Compound Name | (2R)-2-[(2,4-dimethylphenyl)sulfanylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 102820293 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2R)-2-[(2,4-dimethylphenyl)sulfanylmethyl]pyrrolidine |
| SMILES | Cc1ccc(SC[C@H]2CCCN2)c(C)c1 |
| InChI | InChI=1S/C13H19NS/c1-10-5-6-13(11(2)8-10)15-9-12-4-3-7-14-12/h5-6,8,12,14H,3-4,7,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | XRVCEQRPWHXGCC-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |