C12H18N2OS — CID 102820443
3-methoxy-4-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]aniline (PubChem CID 102820443) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-methoxy-4-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]aniline.
| Compound Name | 3-methoxy-4-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]aniline |
|---|---|
| PubChem CID | 102820443 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-methoxy-4-[[(2R)-pyrrolidin-2-yl]methylsulfanyl]aniline |
| SMILES | COc1cc(N)ccc1SC[C@H]1CCCN1 |
| InChI | InChI=1S/C12H18N2OS/c1-15-11-7-9(13)4-5-12(11)16-8-10-3-2-6-14-10/h4-5,7,10,14H,2-3,6,8,13H2,1H3/t10-/m1/s1 |
| InChIKey | PQQURKJWUKCRNB-SNVBAGLBSA-N |
| XLogP | 2.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|