C14H21NO2S — CID 117033099
2-[(3,4-dimethoxyphenyl)sulfanylmethyl]piperidine (PubChem CID 117033099) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfanylmethyl]piperidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)sulfanylmethyl]piperidine |
|---|---|
| PubChem CID | 117033099 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)sulfanylmethyl]piperidine |
| SMILES | COc1ccc(SCC2CCCCN2)cc1OC |
| InChI | InChI=1S/C14H21NO2S/c1-16-13-7-6-12(9-14(13)17-2)18-10-11-5-3-4-8-15-11/h6-7,9,11,15H,3-5,8,10H2,1-2H3 |
| InChIKey | MVFOMEWQTITITJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |