C14H21NO2 — CID 62800646
2-[(2,4-dimethoxyphenyl)methyl]piperidine (PubChem CID 62800646) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]piperidine.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 62800646 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]piperidine |
| SMILES | COc1ccc(CC2CCCCN2)c(OC)c1 |
| InChI | InChI=1S/C14H21NO2/c1-16-13-7-6-11(14(10-13)17-2)9-12-5-3-4-8-15-12/h6-7,10,12,15H,3-5,8-9H2,1-2H3 |
| InChIKey | JMFFEMGYIRXIGG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |