C15H21F2NO2 — CID 117459511
2-[[4-(difluoromethyl)-2,5-dimethoxyphenyl]methyl]piperidine (PubChem CID 117459511) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-[[4-(difluoromethyl)-2,5-dimethoxyphenyl]methyl]piperidine.
| Compound Name | 2-[[4-(difluoromethyl)-2,5-dimethoxyphenyl]methyl]piperidine |
|---|---|
| PubChem CID | 117459511 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[[4-(difluoromethyl)-2,5-dimethoxyphenyl]methyl]piperidine |
| SMILES | COc1cc(C(F)F)c(OC)cc1CC1CCCCN1 |
| InChI | InChI=1S/C15H21F2NO2/c1-19-13-9-12(15(16)17)14(20-2)8-10(13)7-11-5-3-4-6-18-11/h8-9,11,15,18H,3-7H2,1-2H3 |
| InChIKey | UCJQJHHDRFILNK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |