C22H25NO3 — CID 71396682
(2S)-2-[(3,5,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine (PubChem CID 71396682) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-2-[(3,5,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine.
| Compound Name | (2S)-2-[(3,5,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 71396682 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (2S)-2-[(3,5,6-trimethoxyphenanthren-9-yl)methyl]pyrrolidine |
| SMILES | COc1ccc2cc(C[C@@H]3CCCN3)c3ccc(OC)c(OC)c3c2c1 |
| InChI | InChI=1S/C22H25NO3/c1-24-17-7-6-14-11-15(12-16-5-4-10-23-16)18-8-9-20(25-2)22(26-3)21(18)19(14)13-17/h6-9,11,13,16,23H,4-5,10,12H2,1-3H3/t16-/m0/s1 |
| InChIKey | XNUBWNDIAUSSJR-INIZCTEOSA-N |
| XLogP | 4.31 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|