C13H20ClNO2 — CID 171194815
(2S)-2-(3,4-dimethoxyphenyl)piperidine;hydrochloride (PubChem CID 171194815) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)piperidine;hydrochloride.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 171194815 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)piperidine;hydrochloride |
| SMILES | COc1ccc([C@@H]2CCCCN2)cc1OC.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-15-12-7-6-10(9-13(12)16-2)11-5-3-4-8-14-11;/h6-7,9,11,14H,3-5,8H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | DPAWBZLIOBAOPQ-MERQFXBCSA-N |
| XLogP | 2.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |