C19H23NO2 — CID 171195670
(2R)-2-(4-methoxy-3-phenylmethoxyphenyl)piperidine (PubChem CID 171195670) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R)-2-(4-methoxy-3-phenylmethoxyphenyl)piperidine.
| Compound Name | (2R)-2-(4-methoxy-3-phenylmethoxyphenyl)piperidine |
|---|---|
| PubChem CID | 171195670 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2R)-2-(4-methoxy-3-phenylmethoxyphenyl)piperidine |
| SMILES | COc1ccc([C@H]2CCCCN2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-21-18-11-10-16(17-9-5-6-12-20-17)13-19(18)22-14-15-7-3-2-4-8-15/h2-4,7-8,10-11,13,17,20H,5-6,9,12,14H2,1H3/t17-/m1/s1 |
| InChIKey | UTCCVQRCHICLFA-QGZVFWFLSA-N |
| XLogP | 4.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |