C18H23ClN2O2 — CID 171194691
(2R)-2-(3-methoxy-4-phenylmethoxyphenyl)piperazine;hydrochloride (PubChem CID 171194691) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is (2R)-2-(3-methoxy-4-phenylmethoxyphenyl)piperazine;hydrochloride.
| Compound Name | (2R)-2-(3-methoxy-4-phenylmethoxyphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 171194691 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2R)-2-(3-methoxy-4-phenylmethoxyphenyl)piperazine;hydrochloride |
| SMILES | COc1cc([C@@H]2CNCCN2)ccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C18H22N2O2.ClH/c1-21-18-11-15(16-12-19-9-10-20-16)7-8-17(18)22-13-14-5-3-2-4-6-14;/h2-8,11,16,19-20H,9-10,12-13H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | RBRKRXNUIFSYTL-NTISSMGPSA-N |
| XLogP | 2.93 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |