C12H14BrF2NS — CID 114224160
3-bromo-4-[(3,3-difluorocyclopentyl)methylsulfanyl]aniline (PubChem CID 114224160) has the molecular formula C12H14BrF2NS and a molecular weight of 322.22 g/mol. Its IUPAC name is 3-bromo-4-[(3,3-difluorocyclopentyl)methylsulfanyl]aniline.
| Compound Name | 3-bromo-4-[(3,3-difluorocyclopentyl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 114224160 |
| Molecular Formula | C12H14BrF2NS |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 3-bromo-4-[(3,3-difluorocyclopentyl)methylsulfanyl]aniline |
| SMILES | Nc1ccc(SCC2CCC(F)(F)C2)c(Br)c1 |
| InChI | InChI=1S/C12H14BrF2NS/c13-10-5-9(16)1-2-11(10)17-7-8-3-4-12(14,15)6-8/h1-2,5,8H,3-4,6-7,16H2 |
| InChIKey | AILQEBXOIQPDDO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|