C13H16F2OS — CID 114224994
2-[(3,3-difluorocyclohexyl)methylsulfanyl]phenol (PubChem CID 114224994) has the molecular formula C13H16F2OS and a molecular weight of 258.33 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclohexyl)methylsulfanyl]phenol.
| Compound Name | 2-[(3,3-difluorocyclohexyl)methylsulfanyl]phenol |
|---|---|
| PubChem CID | 114224994 |
| Molecular Formula | C13H16F2OS |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-[(3,3-difluorocyclohexyl)methylsulfanyl]phenol |
| SMILES | Oc1ccccc1SCC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H16F2OS/c14-13(15)7-3-4-10(8-13)9-17-12-6-2-1-5-11(12)16/h1-2,5-6,10,16H,3-4,7-9H2 |
| InChIKey | QABZTLQVZNJFRM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |