C13H14F3NO — CID 114224626
2-(3,3-difluorocyclohexyl)-1-(3-fluoro-2-pyridinyl)ethanone (PubChem CID 114224626) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-(3,3-difluorocyclohexyl)-1-(3-fluoro-2-pyridinyl)ethanone.
| Compound Name | 2-(3,3-difluorocyclohexyl)-1-(3-fluoro-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 114224626 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-(3,3-difluorocyclohexyl)-1-(3-fluoro-2-pyridinyl)ethanone |
| SMILES | O=C(CC1CCCC(F)(F)C1)c1ncccc1F |
| InChI | InChI=1S/C13H14F3NO/c14-10-4-2-6-17-12(10)11(18)7-9-3-1-5-13(15,16)8-9/h2,4,6,9H,1,3,5,7-8H2 |
| InChIKey | DLAARERXINQQEX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |