C14H16F3NO — CID 114225535
1-(4-amino-3-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone (PubChem CID 114225535) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-(4-amino-3-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone.
| Compound Name | 1-(4-amino-3-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone |
|---|---|
| PubChem CID | 114225535 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-(4-amino-3-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone |
| SMILES | Nc1ccc(C(=O)CC2CCCC(F)(F)C2)cc1F |
| InChI | InChI=1S/C14H16F3NO/c15-11-7-10(3-4-12(11)18)13(19)6-9-2-1-5-14(16,17)8-9/h3-4,7,9H,1-2,5-6,8,18H2 |
| InChIKey | UYIDQOFXPBCPPM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|