C14H16BrF2NO — CID 114224634
1-(2-amino-5-bromophenyl)-2-(3,3-difluorocyclohexyl)ethanone (PubChem CID 114224634) has the molecular formula C14H16BrF2NO and a molecular weight of 332.19 g/mol. Its IUPAC name is 1-(2-amino-5-bromophenyl)-2-(3,3-difluorocyclohexyl)ethanone.
| Compound Name | 1-(2-amino-5-bromophenyl)-2-(3,3-difluorocyclohexyl)ethanone |
|---|---|
| PubChem CID | 114224634 |
| Molecular Formula | C14H16BrF2NO |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 1-(2-amino-5-bromophenyl)-2-(3,3-difluorocyclohexyl)ethanone |
| SMILES | Nc1ccc(Br)cc1C(=O)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H16BrF2NO/c15-10-3-4-12(18)11(7-10)13(19)6-9-2-1-5-14(16,17)8-9/h3-4,7,9H,1-2,5-6,8,18H2 |
| InChIKey | ISJMVSQAJNCJBO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|