C14H14BrF3O — CID 114224650
1-(5-bromo-2-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone (PubChem CID 114224650) has the molecular formula C14H14BrF3O and a molecular weight of 335.16 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone |
|---|---|
| PubChem CID | 114224650 |
| Molecular Formula | C14H14BrF3O |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-2-(3,3-difluorocyclohexyl)ethanone |
| SMILES | O=C(CC1CCCC(F)(F)C1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H14BrF3O/c15-10-3-4-12(16)11(7-10)13(19)6-9-2-1-5-14(17,18)8-9/h3-4,7,9H,1-2,5-6,8H2 |
| InChIKey | DRWFTBMDXNTTKB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |