C16H18F4O — CID 107291304
2-cycloheptyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanone (PubChem CID 107291304) has the molecular formula C16H18F4O and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-cycloheptyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-cycloheptyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 107291304 |
| Molecular Formula | C16H18F4O |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-cycloheptyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CC1CCCCCC1)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C16H18F4O/c17-14-10-12(7-8-13(14)16(18,19)20)15(21)9-11-5-3-1-2-4-6-11/h7-8,10-11H,1-6,9H2 |
| InChIKey | FXXYBWOFWHQDKG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |