C30H42O3 — CID 160549823
1-[3,5-bis(2-cyclohexylacetyl)phenyl]-2-cyclohexylethanone (PubChem CID 160549823) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is 1-[3,5-bis(2-cyclohexylacetyl)phenyl]-2-cyclohexylethanone.
| Compound Name | 1-[3,5-bis(2-cyclohexylacetyl)phenyl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 160549823 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 1-[3,5-bis(2-cyclohexylacetyl)phenyl]-2-cyclohexylethanone |
| SMILES | O=C(CC1CCCCC1)c1cc(C(=O)CC2CCCCC2)cc(C(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C30H42O3/c31-28(16-22-10-4-1-5-11-22)25-19-26(29(32)17-23-12-6-2-7-13-23)21-27(20-25)30(33)18-24-14-8-3-9-15-24/h19-24H,1-18H2 |
| InChIKey | QXXJRUHCQJLUFM-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |