C17H24O3 — CID 115785355
2-cycloheptyl-1-(3,5-dimethoxyphenyl)ethanone (PubChem CID 115785355) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-cycloheptyl-1-(3,5-dimethoxyphenyl)ethanone.
| Compound Name | 2-cycloheptyl-1-(3,5-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 115785355 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-cycloheptyl-1-(3,5-dimethoxyphenyl)ethanone |
| SMILES | COc1cc(OC)cc(C(=O)CC2CCCCCC2)c1 |
| InChI | InChI=1S/C17H24O3/c1-19-15-10-14(11-16(12-15)20-2)17(18)9-13-7-5-3-4-6-8-13/h10-13H,3-9H2,1-2H3 |
| InChIKey | PMFCKFYZLGNEMX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |